MMP-9 inhibitor I
Modify Date: 2025-09-18 17:53:49
MMP-9 inhibitor I structure
|
Common Name | MMP-9 inhibitor I | ||
|---|---|---|---|---|
| CAS Number | 1177749-58-4 | Molecular Weight | 511.633 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C27H33N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MMP-9 inhibitor IMMP9-IN-I is a cell-permeable, potent, and reversible MMP-9 inhibitor. |
| Name | 2-{Benzyl[(4-methoxyphenyl)sulfonyl]amino}-5-[(diethylamino)methyl]-N-hydroxy-3-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.633 |
| Exact Mass | 511.214081 |
| LogP | 3.38 |
| Index of Refraction | 1.608 |
| InChIKey | WRNMBFWQBKEBIX-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1cc(C)c(N(Cc2ccccc2)S(=O)(=O)c2ccc(OC)cc2)c(C(=O)NO)c1 |
| 2-{Benzyl[(4-methoxyphenyl)sulfonyl]amino}-5-[(diethylamino)methyl]-N-hydroxy-3-methylbenzamide |
| Benzamide, 5-[(diethylamino)methyl]-N-hydroxy-2-[[(4-methoxyphenyl)sulfonyl](phenylmethyl)amino]-3-methyl- |