diphenacyl benzene-1,3-dicarboxylate structure
|
Common Name | diphenacyl benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 116345-97-2 | Molecular Weight | 402.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diphenacyl benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H18O6 |
|---|---|
| Molecular Weight | 402.39600 |
| Exact Mass | 402.11000 |
| PSA | 86.74000 |
| LogP | 3.76600 |
| InChIKey | NWTODHNVXLOHFQ-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1cccc(C(=O)OCC(=O)c2ccccc2)c1)c1ccccc1 |
|
~%
diphenacyl benz... CAS#:116345-97-2 |
| Literature: Kelly; Kleff Journal of the American Chemical Society, 1932 , vol. 54, p. 4444 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| isophthalic acid diphenacyl ester |
| Diphenacyl isophthalate |
| Isophthalsaeure-diphenacylester |