bis(ethoxycarbonyl) benzene-1,3-dicarboxylate structure
|
Common Name | bis(ethoxycarbonyl) benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 22483-52-9 | Molecular Weight | 310.25600 | |
| Density | 1.302g/cm3 | Boiling Point | 419.4ºC at 760mmHg | |
| Molecular Formula | C14H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5ºC | |
| Name | bis(ethoxycarbonyl) benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 419.4ºC at 760mmHg |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.25600 |
| Flash Point | 185.5ºC |
| Exact Mass | 310.06900 |
| PSA | 105.20000 |
| LogP | 2.31320 |
| Vapour Pressure | 3.05E-07mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | SXIBCLRNZISNIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC(=O)c1cccc(C(=O)OC(=O)OCC)c1 |
| Isophthalic acid,dianhydride with diethyl bis(hydrogen carbonate) |
| EINECS 245-027-0 |