dioctyl benzene-1,3-dicarboxylate
Modify Date: 2025-08-23 22:52:40
dioctyl benzene-1,3-dicarboxylate structure
|
Common Name | dioctyl benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4654-18-6 | Molecular Weight | 390.55600 | |
| Density | 0.985g/cm3 | Boiling Point | 423.2ºC at 760 mmHg | |
| Molecular Formula | C24H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.2ºC | |
| Name | dioctyl benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760 mmHg |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.55600 |
| Flash Point | 226.2ºC |
| Exact Mass | 390.27700 |
| PSA | 52.60000 |
| LogP | 6.72120 |
| Index of Refraction | 1.49 |
| InChIKey | LERGDXJITDVDBZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1cccc(C(=O)OCCCCCCCC)c1 |
| HS Code | 2917399090 |
|---|
|
~%
dioctyl benzene... CAS#:4654-18-6 |
| Literature: Barry, J.; Bram, G.; Decodts, G.; Loupy, A.; Orange, C.; et al. Synthesis, 1985 , # 1 p. 40 - 45 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| isophthalic acid dioctyl ester |
| Dioctylisophthalat |
| Di-n-octylisophthalate |
| Dioctyl isophthalate |
| Isophthalsaeure-dioctylester |