pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate
Modify Date: 2025-08-25 19:28:51
pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate structure
|
Common Name | pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate | ||
|---|---|---|---|---|
| CAS Number | 99627-63-1 | Molecular Weight | 374.34000 | |
| Density | 1.284g/cm3 | Boiling Point | 431.5ºC at 760mmHg | |
| Molecular Formula | C16H22O10 | Melting Point | 105-107ºC | |
| MSDS | N/A | Flash Point | 187ºC | |
| Name | pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 431.5ºC at 760mmHg |
| Melting Point | 105-107ºC |
| Molecular Formula | C16H22O10 |
| Molecular Weight | 374.34000 |
| Flash Point | 187ºC |
| Exact Mass | 374.12100 |
| PSA | 131.50000 |
| Index of Refraction | 1.476 |
| InChIKey | JSIMVXDUJAWHOE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C(=O)OC)(C(=O)OC)CC(C(=O)OC)(C(=O)OC)C1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2917209090 |
|
~%
pentamethyl cyc... CAS#:99627-63-1
Detail
|
| Literature: Quast, Helmut; Goerlach, Yvonne; Stawitz, Josef Liebigs Annalen der Chemie, 1985 , # 8 p. 1653 - 1658 |
|
~%
pentamethyl cyc... CAS#:99627-63-1
Detail
|
| Literature: Quast, Helmut; Goerlach, Yvonne; Stawitz, Josef Liebigs Annalen der Chemie, 1985 , # 8 p. 1653 - 1658 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| OR0695 |
| 1,1,3,3,5-Cyclohexanpentacarbonsaeure-pentamethylester |
| 1,1,3,3,5-pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate |