erythromycin 2'-acetate structure
|
Common Name | erythromycin 2'-acetate | ||
|---|---|---|---|---|
| CAS Number | 992-69-8 | Molecular Weight | 775.96300 | |
| Density | 1.2g/cm3 | Boiling Point | 819.9ºC at 760mmHg | |
| Molecular Formula | C39H69NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 449.7ºC | |
| Name | Acetylcyclopentanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 819.9ºC at 760mmHg |
| Molecular Formula | C39H69NO14 |
| Molecular Weight | 775.96300 |
| Flash Point | 449.7ºC |
| Exact Mass | 775.47200 |
| PSA | 199.98000 |
| LogP | 2.35640 |
| Index of Refraction | 1.528 |
| InChIKey | CVBHEIRZLPKMSH-SNWVVRALSA-N |
| SMILES | CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(OC2OC(C)CC(N(C)C)C2OC(C)=O)C(C)(O)CC(C)C(=O)C(C)C(O)C1(C)O |
|
~89%
erythromycin 2'... CAS#:992-69-8 |
| Literature: Qi, Yunkun; Jiao, Bo; Ma, Xiaodong; Cui, Wenping; Ma, Shutao Archiv der Pharmazie, 2010 , vol. 343, # 8 p. 458 - 464 |
|
~%
erythromycin 2'... CAS#:992-69-8 |
| Literature: E. Lilly and Co. Patent: US2993833 , 1958 ; |
| 2-acetocyclopentanone |
| 2'-acetyl erythromycin |
| 2-acetyl-1-cyclopentanone |
| 2-acetyl-dec-2-enoic acid ethyl ester |
| O''-Acetyl-erythromycin |
| Cyclopentanone,2-acetyl |
| 2'-O-acetylerythromycin A |
| 2'-acetylerythromycin A |
| 2-oxo-3-ethoxycarbonyl-3E-undecene |
| Acetylcyclopentanone |