Demecycline structure
|
Common Name | Demecycline | ||
|---|---|---|---|---|
| CAS Number | 987-02-0 | Molecular Weight | 430.40800 | |
| Density | 1.69g/cm3 | Boiling Point | 693.5ºC at 760mmHg | |
| Molecular Formula | C21H22N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 373.2ºC | |
Use of DemecyclineDemecycline is the C6-demethylated derivative of Tetracycline (HY-A0107) against bacterial infections including pneumonia and other respiratory tract infections[1]. |
| Name | (4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Demecycline is the C6-demethylated derivative of Tetracycline (HY-A0107) against bacterial infections including pneumonia and other respiratory tract infections[1]. |
|---|---|
| Related Catalog | |
| References |
[2]. Results from the Swedish national screening programme 2005. |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 693.5ºC at 760mmHg |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.40800 |
| Flash Point | 373.2ºC |
| Exact Mass | 430.13800 |
| PSA | 182.61000 |
| LogP | 0.76120 |
| Index of Refraction | 1.757 |
| InChIKey | RMVMLZHPWMTQGK-SOUFLCLCSA-N |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(O)C3CC12 |
| A IX |
| Demecycline |
| Demethyltetracycline |
| Demecyclinum |
| Demeciclina |
| Demecycline (USAN/INN) |
| 6-Demethyltetracyclin |