Methyl 2-(bromomethyl)-3-nitrobenzoate structure
|
Common Name | Methyl 2-(bromomethyl)-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 98475-07-1 | Molecular Weight | 274.068 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 370.9±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | 72-74ºC | |
| MSDS | N/A | Flash Point | 178.1±25.1 °C | |
| Name | Methyl 2-Bromomethyl-3-Nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.9±32.0 °C at 760 mmHg |
| Melting Point | 72-74ºC |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.068 |
| Flash Point | 178.1±25.1 °C |
| Exact Mass | 272.963654 |
| PSA | 72.12000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | FCGIVHSBEKGQMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1CBr |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| RIDADR | UN 3261 8/PG III |
| Packaging Group | III |
| HS Code | 2916399090 |
|
~86%
Methyl 2-(bromo... CAS#:98475-07-1 |
| Literature: Kumiai Chemical Industry Co., Ltd.; Ihara Chemical Industry Co., Ltd. Patent: US5534481 A1, 1996 ; |
|
~99%
Methyl 2-(bromo... CAS#:98475-07-1 |
| Literature: Bayer Healthcare AG Patent: US2010/10060 A1, 2010 ; Location in patent: Page/Page column 19 ; |
|
~%
Methyl 2-(bromo... CAS#:98475-07-1 |
| Literature: US4521241 A1, ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl 2-(bromomethyl)-3-nitrobenzoate |
| Benzoic acid, 2-(bromomethyl)-3-nitro-, methyl ester |