Hydroxytuberosone
Modify Date: 2025-08-22 22:10:47
Hydroxytuberosone structure
|
Common Name | Hydroxytuberosone | ||
|---|---|---|---|---|
| CAS Number | 95456-43-2 | Molecular Weight | 354.353 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 603.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2±25.0 °C | |
Use of Hydroxytuberosone(+)-Hydroxytuberosone (compound 7) is a natural pterocarpanone found in Kudzu vine[1]. |
| Name | N-Isopropylaniline sulfate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Hydroxytuberosone (compound 7) is a natural pterocarpanone found in Kudzu vine[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 603.0±55.0 °C at 760 mmHg |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.353 |
| Flash Point | 221.2±25.0 °C |
| Exact Mass | 354.110352 |
| PSA | 85.22000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | PDSPTIAGLVOKKO-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2cc3c(cc2O1)OC1C2(O)C=CC(=O)C=C2OCC31O |
| Hazard Codes | Xi |
|---|
| 3H,10H-Pyrano[3',2':5,6]benzofuro[3,2-c][1]benzopyran-3-one, 6,6a,13a,13b-tetrahydro-6a,13b-dihydroxy-10,10-dimethyl-, (6aR,13aS)- |
| Hydroxytuberosin |
| (6aR,13aS)-6a,13b-Dihydroxy-10,10-dimethyl-6,6a,13a,13b-tetrahydro-3H,10H-chromeno[6',7':4,5]furo[3,2-c]chromen-3-one |