Methyl 8-chloro-4-oxo-1,4-dihydroquinoline-7-carboxylate structure
|
Common Name | Methyl 8-chloro-4-oxo-1,4-dihydroquinoline-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 948573-54-4 | Molecular Weight | 237.639 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 397.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.0±27.9 °C | |
| Name | methyl 8-chloro-4-oxo-1H-quinoline-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.2±42.0 °C at 760 mmHg |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.639 |
| Flash Point | 194.0±27.9 °C |
| Exact Mass | 237.019272 |
| PSA | 59.42000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | UERUOGNUVCRUFR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(=O)cc[nH]c2c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~97%
Methyl 8-chloro... CAS#:948573-54-4 |
| Literature: Morgentin, Remy; Pasquet, Georges; Boutron, Pascal; Jung, Frederic; Lamorlette, Maryannick; Maudet, Mickael; Ple, Patrick Tetrahedron, 2008 , vol. 64, # 12 p. 2772 - 2782 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Quinolinecarboxylic acid, 8-chloro-1,4-dihydro-4-oxo-, methyl ester |
| 8-chloro-7-methoxycarbonyl-1,4-dihydroquinolin-4-one |
| Methyl 8-chloro-4-oxo-1,4-dihydro-7-quinolinecarboxylate |
| METHYL 8-CHLORO-4-OXO-1,4-DIHYDROQUINOLINE-7-CARBOXYLATE |
| 8-Chloro-4-oxo-1,4-dihydro-quinoline-7-carboxylic acid methyl ester |