AMG0347
Modify Date: 2025-09-24 14:12:01
AMG0347 structure
|
Common Name | AMG0347 | ||
|---|---|---|---|---|
| CAS Number | 946615-43-6 | Molecular Weight | 445.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AMG0347AMG0347 is a transient receptor potential type V1 receptor antagonist. AMG0347 inhibits activation of the rat TRPV1 channel by heat (IC50 = 0.2 nm), protons (IC50= 0.8 nm), or capsaicin (IC50 = 0.7 nm)[1]. |
| Name | (E)-N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-[2-piperidin-1-yl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Description | AMG0347 is a transient receptor potential type V1 receptor antagonist. AMG0347 inhibits activation of the rat TRPV1 channel by heat (IC50 = 0.2 nm), protons (IC50= 0.8 nm), or capsaicin (IC50 = 0.7 nm)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H26F3N3O2 |
|---|---|
| Molecular Weight | 445.47700 |
| Exact Mass | 445.19800 |
| PSA | 68.95000 |
| LogP | 5.30670 |
| InChIKey | YCDWBIUKUBHSKQ-FMIVXFBMSA-N |
| SMILES | O=C(C=Cc1ccc(C(F)(F)F)nc1N1CCCCC1)Nc1cccc2c1CC(O)CC2 |
| amg 0347 |
| unii-cd7l9290qr |