osmanthuside B
Modify Date: 2025-08-24 22:40:45
osmanthuside B structure
|
Common Name | osmanthuside B | ||
|---|---|---|---|---|
| CAS Number | 94492-23-6 | Molecular Weight | 592.58800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H36O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of osmanthuside BOsmanthuside B can be isolated from Pseuderanthemum carruthersii (Seem.) Guill. var. atropurpureum (Bull.) Fosb and has weak acetylcholinesterase inhibitory activity[1]. |
| Name | osmanthuside B |
|---|---|
| Synonym | More Synonyms |
| Description | Osmanthuside B can be isolated from Pseuderanthemum carruthersii (Seem.) Guill. var. atropurpureum (Bull.) Fosb and has weak acetylcholinesterase inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H36O13 |
|---|---|
| Molecular Weight | 592.58800 |
| Exact Mass | 592.21600 |
| PSA | 204.83000 |
| InChIKey | PRTREKIVGSNQRM-DQHNYDBYSA-N |
| SMILES | CC1OC(OC2C(O)C(OCCc3ccc(O)cc3)OC(CO)C2OC(=O)C=Cc2ccc(O)cc2)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| (E)-3-(4-Hydroxy-phenyl)-acrylic acid (2R,3R,4R,5R,6R)-5-hydroxy-2-hydroxymethyl-6-[2-(4-hydroxy-phenyl)-ethoxy]-4-((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-tetrahydro-pyran-2-yloxy)-tetrahydro-pyran-3-yl ester |