tert-Butyl 3-bromopyrrolidine-1-carboxylate structure
|
Common Name | tert-Butyl 3-bromopyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 939793-16-5 | Molecular Weight | 250.133 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 277.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C9H16BrNO2 | Melting Point | 47-52°C | |
| MSDS | Chinese USA | Flash Point | 121.6±25.4 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | N-Boc-3-Bromopyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.5±33.0 °C at 760 mmHg |
| Melting Point | 47-52°C |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.133 |
| Flash Point | 121.6±25.4 °C |
| Exact Mass | 249.036438 |
| PSA | 29.54000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | QJTKPXFJOXKUEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(Br)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2933990090 |
|
~82%
tert-Butyl 3-br... CAS#:939793-16-5 |
| Literature: SIGMA-TAU INDUSTRIE FARMACEUTICHE RIUNITE S.P.A. Patent: WO2007/118830 A1, 2007 ; Location in patent: Page/Page column 139 ; WO 2007/118830 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Boc-3-Bromopyrrolidine |
| tert-butyl 3-bromopyrrolidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-bromo-1-pyrrolidinecarboxylate |
| 1-Pyrrolidinecarboxylic acid, 3-bromo-, 1,1-dimethylethyl ester |