tert-butyl 3-carbamoylazetidine-1-carboxylate structure
|
Common Name | tert-butyl 3-carbamoylazetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 486415-29-6 | Molecular Weight | 200.235 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 355.9±31.0 °C at 760 mmHg | |
| Molecular Formula | C9H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.0±24.8 °C | |
| Name | tert-butyl 3-carbamoylazetidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.9±31.0 °C at 760 mmHg |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.235 |
| Flash Point | 169.0±24.8 °C |
| Exact Mass | 200.116089 |
| PSA | 73.62000 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | AGMQPVHOELDCAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(N)=O)C1 |
| HS Code | 2933990090 |
|---|
|
~64%
tert-butyl 3-ca... CAS#:486415-29-6 |
| Literature: Incyte Corporation; Li, Yun-Long; Zhu, Wenyu; Mei, Song; Glenn, Joseph Patent: US2014/121198 A1, 2014 ; Location in patent: Paragraph 0688; 0689 ; |
|
~%
tert-butyl 3-ca... CAS#:486415-29-6 |
| Literature: Itani, Hiromichi; Ito, Harunobu; Sakata, Yoshihiko; Hatakeyama, Yoshifumi; Oohashi, Hiroko; Satoh, Yoshinari Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 5 p. 757 - 761 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-carbamoyl-azetidine-1-carboxylic acid tert-butyl ester |
| 1-Azetidinecarboxylic acid, 3-(aminocarbonyl)-, 1,1-dimethylethyl ester |
| tert-butyl 3-(aminocarbonyl)azetidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-carbamoyl-1-azetidinecarboxylate |