Kaempferol 3-sophoroside-7-rhamnoside structure
|
Common Name | Kaempferol 3-sophoroside-7-rhamnoside | ||
|---|---|---|---|---|
| CAS Number | 93098-79-4 | Molecular Weight | 756.659 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 1111.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C33H40O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.5±27.8 °C | |
Use of Kaempferol 3-sophoroside-7-rhamnosideKaempferol 3-sophoroside 7-rhamnoside, isolated from Solanum tuberosum (potato), acts as a potential biomarker[1]. |
| Name | 4H-1-Benzopyran-4-one, 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-3-[(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl) |
|---|---|
| Synonym | More Synonyms |
| Description | Kaempferol 3-sophoroside 7-rhamnoside, isolated from Solanum tuberosum (potato), acts as a potential biomarker[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 1111.4±65.0 °C at 760 mmHg |
| Molecular Formula | C33H40O20 |
| Molecular Weight | 756.659 |
| Flash Point | 349.5±27.8 °C |
| Exact Mass | 756.211304 |
| PSA | 328.35000 |
| LogP | -1.08 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.743 |
| InChIKey | VRYWDBDPXMHHGE-IAYTZLMWSA-N |
| SMILES | CC1OC(Oc2cc(O)c3c(=O)c(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)c(-c4ccc(O)cc4)oc3c2)C(O)C(O)C1O |
| 4H-1-Benzopyran-4-one, 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-3-[(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)- |
| Kaempferol 3-O--D-sophoroside-7-O--L-rhamnoside |
| Kaempferol 3-sophoroside 7-rhamnoside |
| Kaempferol 3-O-β-D-sophoroside 7-O-α-L-rhamnoside |
| Kaempferol 3-O-sophoroside 7-O-rhamnoside |
| 7-[(6-Deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Kaempferol 3-sophoroside-7-rhamnoside |