Iotalamic acid-d3 structure
|
Common Name | Iotalamic acid-d3 | ||
|---|---|---|---|---|
| CAS Number | 928623-31-8 | Molecular Weight | 613.91400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9I3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Iotalamic acid-d3Iotalamic acid-d3 is the deuterium labeled Iotalamic acid[1]. |
| Name | Benzoic acid, 3-(acetyl-2,2,2-d3-amino)-2,4,6-triiodo-5-[(methylamino)carbonyl] |
|---|---|
| Synonym | More Synonyms |
| Description | Iotalamic acid-d3 is the deuterium labeled Iotalamic acid[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C11H9I3N2O4 |
|---|---|
| Molecular Weight | 613.91400 |
| Exact Mass | 613.77000 |
| PSA | 95.50000 |
| LogP | 2.98050 |
| InChIKey | UXIGWFXRQKWHHA-FIBGUPNXSA-N |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| Iothalamic Acid-d3 |