Mycophenolic acid D3
Modify Date: 2025-09-08 21:05:27
Mycophenolic acid D3 structure
|
Common Name | Mycophenolic acid D3 | ||
|---|---|---|---|---|
| CAS Number | 1185242-90-3 | Molecular Weight | 323.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17D3O6 | Melting Point | 132-134°C | |
| MSDS | N/A | Flash Point | 2℃ | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of Mycophenolic acid D3Mycophenolic acid D3 is deuterium labeled Mycophenolic acid, which is an an immunosuppresant drug and has potent anti-proliferative activity. |
| Name | Mycophenolic acid d3 |
|---|
| Description | Mycophenolic acid D3 is deuterium labeled Mycophenolic acid, which is an an immunosuppresant drug and has potent anti-proliferative activity. |
|---|---|
| Related Catalog |
| Melting Point | 132-134°C |
|---|---|
| Molecular Formula | C17H17D3O6 |
| Molecular Weight | 323.35600 |
| Flash Point | 2℃ |
| Exact Mass | 323.14500 |
| PSA | 93.06000 |
| LogP | 2.73320 |
| InChIKey | HPNSFSBZBAHARI-HZIIEIAOSA-N |
| SMILES | COc1c(C)c2c(c(O)c1CC=C(C)CCC(=O)O)C(=O)OC2 |
| Storage condition | -20°C Freezer |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H332-H319-H412 |
| Precautionary Statements | P210-P273-P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Phrases | 11-20/21/22-36-52/53 |
| Safety Phrases | 16-36/37-61-26 |
| RIDADR | UN 1648 3 / PGII |
|
A Serotonin Circuit Acts as an Environmental Sensor to Mediate Midline Axon Crossing through EphrinB2.
J. Neurosci. 35 , 14794-808, (2015) Modulation of connectivity formation in the developing brain in response to external stimuli is poorly understood. Here, we show that the raphe nucleus and its serotonergic projections regulate pathfi... |