Iotalamic acid
Modify Date: 2025-08-24 18:00:59
Iotalamic acid structure
|
Common Name | Iotalamic acid | ||
|---|---|---|---|---|
| CAS Number | 2276-90-6 | Molecular Weight | 613.91400 | |
| Density | 2.54 g/cm3 | Boiling Point | 520.2ºC at 760 mmHg | |
| Molecular Formula | C11H9I3N2O4 | Melting Point | 285ºC | |
| MSDS | N/A | Flash Point | 268.4ºC | |
Use of Iotalamic acidLotalamic acid is a molecule used as a contrast medium. |
| Name | 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Lotalamic acid is a molecule used as a contrast medium. |
|---|---|
| Related Catalog |
| Density | 2.54 g/cm3 |
|---|---|
| Boiling Point | 520.2ºC at 760 mmHg |
| Melting Point | 285ºC |
| Molecular Formula | C11H9I3N2O4 |
| Molecular Weight | 613.91400 |
| Flash Point | 268.4ºC |
| Exact Mass | 613.77000 |
| PSA | 95.50000 |
| LogP | 2.98050 |
| InChIKey | UXIGWFXRQKWHHA-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| Storage condition | 2-8℃ |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Acetylamino-2,4,6-triiod-3-<N-methyl-carbamoyl>-benzoesaeure |
| 2.4.6-Trijod-5-acetamino-N-methyl-phthalamidsaeure,(iothalamic acid) |
| MI 216 |
| UNII-16CHD79MIX |
| Acide iotalamique [INN-French] |
| EINECS 218-897-4 |
| iothalamate |
| Acido iotalamico [INN-Spanish] |
| iotalamic acid |
| 2,4,6-Triiod-5-acetamino-isophthalsaeure-mono-methylamid |
| 5-acetamido-2,4,6-triiodo-N-methylisophthalamic acid |
| Acidum jotalamicum |
| Acidum iotalamicum [INN-Latin] |
| IOTHALAMIC ACID |