(1H-benzimidazol-2-ylmethyl)methylamine dihydrochloride structure
|
Common Name | (1H-benzimidazol-2-ylmethyl)methylamine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 92809-96-6 | Molecular Weight | 234.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1H-Benzimidazol-2-yl)-N-methylmethanamine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H13Cl2N3 |
|---|---|
| Molecular Weight | 234.12600 |
| Exact Mass | 233.04900 |
| PSA | 40.71000 |
| LogP | 3.27720 |
| InChIKey | CNFKFLUGCPBOPK-UHFFFAOYSA-N |
| SMILES | CNCc1nc2ccccc2[nH]1.Cl.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~13%
(1H-benzimidazo... CAS#:92809-96-6 |
| Literature: SmithKline Beecham Corporation Patent: US2002/32187 A1, 2002 ; |
|
~72%
(1H-benzimidazo... CAS#:92809-96-6 |
| Literature: Cardwell, Terence J.; Edwards, Alison J.; Hartshorn, Richard M.; Holmes, Rodney J.; McFadyen, W. David Australian Journal of Chemistry, 1997 , vol. 50, # 10 p. 1009 - 1015 |
|
~13%
(1H-benzimidazo... CAS#:92809-96-6 |
| Literature: SmithKline Beecham Corporation Patent: US5977101 A1, 1999 ; |
|
~%
(1H-benzimidazo... CAS#:92809-96-6 |
| Literature: SmithKline Beecham Corporation Patent: US6008213 A1, 1999 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1H-Benzimidazol-2-ylmethyl)-methyl-amin,Dihydrochlorid |
| (1H-benzimidazol-2-ylmethyl)-methyl-amine,dihydrochloride |
| [4-(4-oxo-1,4-dihydro-2H-quinazolin-3-yl)-phenyl]-acetic acid |
| Benzeneacetic acid,4-(1,4-dihydro-4-oxo-3(2H)-quinazolinyl) |
| dihydrochloride 2-(N-methylaminomethyl)benzimidazole |
| Dihydro-chinazolinon-phenylessigsaeure |
| 2-(methylamino)methylbenzimidazole dihydrochloride |