diethyl 2,2-bis(2-bromoprop-2-enyl)propanedioate structure
|
Common Name | diethyl 2,2-bis(2-bromoprop-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 92105-14-1 | Molecular Weight | 398.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2,2-bis(2-bromoprop-2-enyl)propanedioate |
|---|
| Molecular Formula | C13H18Br2O4 |
|---|---|
| Molecular Weight | 398.08800 |
| Exact Mass | 395.95700 |
| PSA | 52.60000 |
| LogP | 3.69640 |
| InChIKey | GXJBCNZIYGMOJX-UHFFFAOYSA-N |
| SMILES | C=C(Br)CC(CC(=C)Br)(C(=O)OCC)C(=O)OCC |
|
~82%
diethyl 2,2-bis... CAS#:92105-14-1 |
| Literature: Grigg, Ronald; Stevenson, Paul; Worakun, Tanachat Tetrahedron, 1988 , vol. 44, # 7 p. 2049 - 2054 |
|
~%
diethyl 2,2-bis... CAS#:92105-14-1 |
| Literature: Perkin; Simonsen Journal of the Chemical Society, 1907 , vol. 91, p. 821 |