diethyl 2-acetamido-2-(2-methylprop-2-enyl)propanedioate structure
|
Common Name | diethyl 2-acetamido-2-(2-methylprop-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 37944-29-9 | Molecular Weight | 271.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-acetamido-2-(2-methylprop-2-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21NO5 |
|---|---|
| Molecular Weight | 271.31000 |
| Exact Mass | 271.14200 |
| PSA | 85.19000 |
| LogP | 1.79400 |
| InChIKey | BXUSHPORVLKTKF-UHFFFAOYSA-N |
| SMILES | C=C(C)CC(NC(C)=O)(C(=O)OCC)C(=O)OCC |
|
~96%
diethyl 2-aceta... CAS#:37944-29-9 |
| Literature: Schmidt Synthesis, 1994 , # 3 p. 300 - 304 |
|
~%
diethyl 2-aceta... CAS#:37944-29-9 |
| Literature: Celmer; Solomons Journal of the American Chemical Society, 1955 , vol. 77, p. 2861,2865 |
| 1-Acetamino-3-methyl-buten-(3)-dicarbonsaeure-(1.1)-diaethylester |
| acetylamino-methallyl-malonic acid diethyl ester |
| ethyl 2-acetamido-2-ethoxycarbonyl-4-methyl-4-pentenoic acid |
| diethyl (acetylamino)(2-methylprop-2-en-1-yl)propanedioate |
| (acetylamino)(2-methyl-2-propenyl)-propanedioic acid,diethyl ester |
| Acetamino-methallyl-malonsaeure-diaethylester |
| Acetylamino-methallyl-malonsaeure-diaethylester |
| diethyl 2-acetamido-2-methallylmalonate |
| Propanedioic acid,(acetylamino)(2-methyl-2-propenyl)-,diethyl ester |