diethyl 2,2-bis[2-(2-nitrophenyl)ethyl]propanedioate
Modify Date: 2025-09-20 10:04:54
![diethyl 2,2-bis[2-(2-nitrophenyl)ethyl]propanedioate Structure](https://image.chemsrc.com/caspic/211/5345-24-4.png)
diethyl 2,2-bis[2-(2-nitrophenyl)ethyl]propanedioate structure
|
Common Name | diethyl 2,2-bis[2-(2-nitrophenyl)ethyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5345-24-4 | Molecular Weight | 458.46100 | |
| Density | 1.265g/cm3 | Boiling Point | 590.9ºC at 760 mmHg | |
| Molecular Formula | C23H26N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4ºC | |
| Name | diethyl 2,2-bis[2-(2-nitrophenyl)ethyl]propanedioate |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 590.9ºC at 760 mmHg |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.46100 |
| Flash Point | 216.4ºC |
| Exact Mass | 458.16900 |
| PSA | 144.24000 |
| LogP | 5.22740 |
| Index of Refraction | 1.568 |
| InChIKey | OXTFSMADTQOBPO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1[N+](=O)[O-])(CCc1ccccc1[N+](=O)[O-])C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~%
diethyl 2,2-bis... CAS#:5345-24-4 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
|
~%
diethyl 2,2-bis... CAS#:5345-24-4 |
| Literature: Dale; Strobel Journal of the American Chemical Society, 1954 , vol. 76, p. 6172 |
![N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethyl-benzenesulfonamide structure](https://image.chemsrc.com/caspic/228/5345-19-7.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |