2,5-Diphenyloxazole structure
|
Common Name | 2,5-Diphenyloxazole | ||
|---|---|---|---|---|
| CAS Number | 92-71-7 | Molecular Weight | 221.254 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 360.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C15H11NO | Melting Point | 72-74 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 162.3±21.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Diphenyloxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.0±0.0 °C at 760 mmHg |
| Melting Point | 72-74 °C(lit.) |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.254 |
| Flash Point | 162.3±21.9 °C |
| Exact Mass | 221.084061 |
| PSA | 26.03000 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | CNRNYORZJGVOSY-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cnc(-c3ccccc3)o2)cc1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | NEGLEGIBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H413 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S25-S24 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | RP6825000 |
| HS Code | 2934999090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
In vitro effects of vitamin supplements on platelet-activating factor and its metabolism in age-related macular degeneration.
Cutan. Ocul. Toxicol. 33(3) , 235-41, (2014) The purpose of our study was to investigate for the first time a series of vitamin supplements used for age-related macular degeneration (AMD) as potential inhibitors of platelet-activating factor (PA... |
|
|
Plant phenolics are detoxified by prophenoloxidase in the insect gut.
Sci. Rep. 5 , 16823, (2015) Plant phenolics are a group of important secondary metabolites that are toxic to many animals and insects if ingested at high concentrations. Because most insects consume plant phenolics daily, they h... |
|
|
Phase transitions in polymer monolayers: Application of the Clapeyron equation to PEO in PPO-PEO Langmuir films.
Adv. Colloid Interface Sci. 222 , 199-214, (2015) In this paper we investigate the application of the two-dimensional Clapeyron law to polymer monolayers. This is a largely unexplored area of research. The main problems are (1) establishing if equili... |
| 2,5-Diphenyl-1,3-oxazole |
| Oxazole, 2,5-diphenyl- |
| MFCD00005306 |
| 2,5-Diphenyloxazole |
| 2,5-diphenyl oxazole |
| EINECS 202-181-3 |