Cot inhibitor-2
Modify Date: 2025-09-18 19:06:30
Cot inhibitor-2 structure
|
Common Name | Cot inhibitor-2 | ||
|---|---|---|---|---|
| CAS Number | 915363-56-3 | Molecular Weight | 539.43500 | |
| Density | 1.45 | Boiling Point | 713.3ºC at 760 mmHg | |
| Molecular Formula | C26H25Cl2FN8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.2ºC | |
Use of Cot inhibitor-2Cot inhibitor-2 is a COT/Tpl2 inhibitor. |
| Name | 8-chloro-4-(3-chloro-4-fluoroanilino)-6-[[1-(1-ethylpiperidin-4-yl)triazol-4-yl]methylamino]quinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Cot inhibitor-2 is a COT/Tpl2 inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.45 |
|---|---|
| Boiling Point | 713.3ºC at 760 mmHg |
| Molecular Formula | C26H25Cl2FN8 |
| Molecular Weight | 539.43500 |
| Flash Point | 385.2ºC |
| Exact Mass | 538.15600 |
| PSA | 94.69000 |
| LogP | 6.24028 |
| Index of Refraction | 1.702 |
| InChIKey | PHNZIIMWDVXPGG-UHFFFAOYSA-N |
| SMILES | CCN1CCC(n2cc(CNc3cc(Cl)c4ncc(C#N)c(Nc5ccc(F)c(Cl)c5)c4c3)nn2)CC1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| substituted 6-aminoquinoline-3-carbonitrile,34 |
| 8-CHLORO-4-[(3-CHLORO-4-FLUOROPHENYL)AMINO]-6-[[[1-(1-ETHYLPIPERIDIN-4-YL)-1H-1,2,3-TRIAZOL-4-YL]METHYL]AMINO]QUINOLINE-3-CARBONITRILE |
| Cot inhibitor-2 |