FGI-103 structure
|
Common Name | FGI-103 | ||
|---|---|---|---|---|
| CAS Number | 907169-69-1 | Molecular Weight | 344.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FGI-103FGI-103 is a small-molecule inhibitor of filovirus that exhibits potent antiviral activity against of EBOV (EC90=330 nM, ZEBOV) and MARV (EC50=2.5 uM, MARV-Ci67). |
| Name | 2-[(E)-2-(5-carbamimidoyl-1-benzofuran-2-yl)ethenyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H16N6O |
|---|---|
| Molecular Weight | 344.37000 |
| Exact Mass | 344.13900 |
| PSA | 141.56000 |
| LogP | 4.64770 |
| InChIKey | OOKWWPFCCCMWIS-ZZXKWVIFSA-N |
| SMILES | N=C(N)c1ccc2oc(C=Cc3nc4ccc(C(=N)N)cc4[nH]3)cc2c1 |
| fgi-103 |
| unii-b14v493d7b |