Fluticasone
Modify Date: 2025-08-21 16:06:45
Fluticasone structure
|
Common Name | Fluticasone | ||
|---|---|---|---|---|
| CAS Number | 90566-53-3 | Molecular Weight | 500.571 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 568.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H31F3O5S | Melting Point | -18.1ºC | |
| MSDS | N/A | Flash Point | 297.5±30.1 °C | |
Use of FluticasoneFluticasone is an inhaled corticosteroid used for respiratory diseases[1]. Fluticasone is a Smo agonist s with a IC50 value of 99 nM. Fluticasone activate Hedgehog signaling and promotes the proliferation of primary neuronal stem/precursor cells[2]. |
| Name | fluticasone |
|---|---|
| Synonym | More Synonyms |
| Description | Fluticasone is an inhaled corticosteroid used for respiratory diseases[1]. Fluticasone is a Smo agonist s with a IC50 value of 99 nM. Fluticasone activate Hedgehog signaling and promotes the proliferation of primary neuronal stem/precursor cells[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Fluticasone (0-10 μM, 2 hours) inhibits the U2OS cells growth with the EC50 of 99 nM[2]. Fluticasone (10-1000 nM, 48 hours) decreases HRV-induced mucin production and involves modulation of SPDEF-regulated genes and extracellular ATP release[3]. |
| In Vivo | Fluticasone (intranasal dropping; 1mg/kg; 7 days) suppresses rhinovirus-induced airways inflammation in vivo but also impairs anti-viral immune responses and increases viral titres, leading to mucus hypersecretion[4]. Animal Model: C57BL/6 mice[4] Dosage: 1 mg/kg Administration: Intranasal dropping; 1 h before infection with rhinovirus 1B; 7 days Result: Suppressed BAL neutrophil numbers and inhibited rhinovirus-induced airway inflammation. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.3±50.0 °C at 760 mmHg |
| Melting Point | -18.1ºC |
| Molecular Formula | C25H31F3O5S |
| Molecular Weight | 500.571 |
| Flash Point | 297.5±30.1 °C |
| Exact Mass | 500.184418 |
| PSA | 105.97000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | MGNNYOODZCAHBA-UHFFFAOYSA-N |
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)SCF |
| Fluticasone propionate (JAN/USAN) |
| Flonase |
| Androsta-1,4-diene-17-carbothioic acid, 6,9-difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)-, S-(fluoromethyl) ester, (6α,11β,16α,17α)- |
| S-(fluoromethyl) (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioate |
| Flovent DPI |
| UNII-CUT2W21N7U |
| Flixonase |
| Flutionum |
| Flutiona [Spanish] |
| (6α,11β,16α,17α)-6,9-Difluoro-17-{[(fluoromethyl)sulfanyl]carbonyl}-11-hydroxy-16-methyl-3-oxoandrosta-1,4-dien-17-yl propionate |
| Flixotide |
| Fluticasone |
| Fluticasone propionate |
| Flutiona |
| flutione |
| Fluticaps (TN) |
| (6α,11β,16α,17α)-6,9-difluoro-17-{[(fluoromethyl)sulfanyl]carbonyl}-11-hydroxy-16-methyl-3-oxoandrosta-1,4-dien-17-yl propanoate |
| (6a,11b,16a,17a)-6,9-Difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)androsta-1,4-diene-17-carbothioic Acid S-(Fluoromethyl) Ester |
| flovent diskus |
| Flutionum [Latin] |
| Flutione (INN) |
| Cutivate |
| MFCD01862254 |