5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride
Modify Date: 2025-08-23 12:12:49
5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride structure
|
Common Name | 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride | ||
|---|---|---|---|---|
| CAS Number | 90217-02-0 | Molecular Weight | 312.77700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClN5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride (CTC) is a redox-sensitive red fluorescent dye. 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride can be used for detecting metabolic activity in microorganisms. The emission maximum of 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride is 602 nm[1]. |
| Name | 2,3-bis(4-methylphenyl)tetrazol-2-ium-5-carbonitrile,chloride |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride (CTC) is a redox-sensitive red fluorescent dye. 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride can be used for detecting metabolic activity in microorganisms. The emission maximum of 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride is 602 nm[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H15ClN5 |
|---|---|
| Molecular Weight | 312.77700 |
| Exact Mass | 312.10200 |
| PSA | 50.42000 |
| InChIKey | SSJZAXOTLCJNLF-UHFFFAOYSA-M |
| SMILES | Cc1ccc(-n2nc(C#N)n[n+]2-c2ccc(C)cc2)cc1.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Severin, E., et al.
Anal. Chim. Acta 170 , 341, (1985)
|
|
|
Rodriguez, G.G., et al.
Appl. Environ. Microbiol. 58 , 180, (1992)
|
| bic1455 |
| MFCD00467521 |