4,4'-bis(Diethylamino)benzophenone structure
|
Common Name | 4,4'-bis(Diethylamino)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 90-93-7 | Molecular Weight | 324.460 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 475.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C21H28N2O | Melting Point | 89-92 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 193.6±16.9 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 4,4'-Bis(diethylamino) benzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.7±30.0 °C at 760 mmHg |
| Melting Point | 89-92 °C(lit.) |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.460 |
| Flash Point | 193.6±16.9 °C |
| Exact Mass | 324.220154 |
| PSA | 23.55000 |
| LogP | 5.99 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | VYHBFRJRBHMIQZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccc(N(CC)CC)cc2)cc1 |
| Water Solubility | insoluble |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S60-S61-S36-S24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | OS9545500 |
| Packaging Group | III |
| Hazard Class | 9 |
| HS Code | 2922399090 |
|
~%
4,4'-bis(Diethy... CAS#:90-93-7 |
| Literature: DE44077 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 24,25 |
|
~%
4,4'-bis(Diethy... CAS#:90-93-7 |
| Literature: Chemische Berichte, , vol. 9, p. 1913 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 202-025-4 |
| Bis[4-(diethylamino)phenyl]methanone |
| Methanone, bis[4- (diethylamino)phenyl]- |
| Methanone, bis[4-(diethylamino)phenyl]- |
| MFCD00009044 |
| 4,4'-bis(Diethylamino)benzophenone |