4,4'-methylenebis[N,N-diethylaniline] structure
|
Common Name | 4,4'-methylenebis[N,N-diethylaniline] | ||
|---|---|---|---|---|
| CAS Number | 135-91-1 | Molecular Weight | 310.47600 | |
| Density | 0.998g/cm3 | Boiling Point | 443.5ºC at 760mmHg | |
| Molecular Formula | C21H30N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | 4-[[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 443.5ºC at 760mmHg |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.47600 |
| Flash Point | 198.3ºC |
| Exact Mass | 310.24100 |
| PSA | 6.48000 |
| LogP | 4.96980 |
| Vapour Pressure | 4.61E-08mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | MIERBLCDXYWVTF-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(Cc2ccc(N(CC)CC)cc2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921590090 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-(diethylamino)benzyl)-N,N-diethylbenzenamine |
| bis<p-(diethylamino)phenyl>methane |
| bis(4-(diethylamino)phenyl)methane |
| 4,4'-Bis(diethylamino)diphenylmethane |
| Benzenamine,4,4'-methylenebis(N,N-diethyl |
| 4,4'-Methylenebis(N,N-diethylaniline) |
| 4-{[4-(diethylamino)phenyl]methyl}-N,N-diethylaniline |
| N,N,N',N'-tetraethyl-4,4'-diaminodiphenylmethane |
| N1,N1-diethyl-4-[4-(diethylamino)benzyl]aniline |
| EINECS 205-224-4 |
| bis(N,N-diethylaminophenyl)methane |