Acetamide, 2-[[3,4-dihydro-6-(4-morpholinyl)-4-oxo-3-(2-phenylethyl)-2-quinazolinyl]thio]-N-[(tetrahydro-2-furanyl)methyl]- structure
|
Common Name | Acetamide, 2-[[3,4-dihydro-6-(4-morpholinyl)-4-oxo-3-(2-phenylethyl)-2-quinazolinyl]thio]-N-[(tetrahydro-2-furanyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 896683-84-4 | Molecular Weight | 508.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Acetamide, 2-[[3,4-dihydro-6-(4-morpholinyl)-4-oxo-3-(2-phenylethyl)-2-quinazolinyl]thio]-N-[(tetrahydro-2-furanyl)methyl]-BC-1471 is a STAM-binding protein (STAMBP) deubiquitinase inhibitor. BC-1471 inhibits NALP7 (NACHT, LRR and PYD domains-containing protein 7) inflammasome activity[1]. |
| Name | Acetamide, 2-[[3,4-dihydro-6-(4-morpholinyl)-4-oxo-3-(2-phenylethyl)-2-quinazolinyl]thio]-N-[(tetrahydro-2-furanyl)methyl]- |
|---|
| Description | BC-1471 is a STAM-binding protein (STAMBP) deubiquitinase inhibitor. BC-1471 inhibits NALP7 (NACHT, LRR and PYD domains-containing protein 7) inflammasome activity[1]. |
|---|---|
| Related Catalog | |
| Target |
STAMBP[1] |
| References |
| Molecular Formula | C27H32N4O4S |
|---|---|
| Molecular Weight | 508.63 |
| InChIKey | GJKRCJKXXVVAMV-UHFFFAOYSA-N |
| SMILES | O=C(CSc1nc2ccc(N3CCOCC3)cc2c(=O)n1CCc1ccccc1)NCC1CCCO1 |