(1H-Indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone structure
|
Common Name | (1H-Indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 895152-66-6 | Molecular Weight | 241.328 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 375.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.0±27.8 °C | |
| Name | (1H-Indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.0±15.0 °C at 760 mmHg |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.328 |
| Flash Point | 188.0±27.8 °C |
| Exact Mass | 241.146667 |
| PSA | 32.86000 |
| LogP | 4.49 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | WYZQBEQQQKCTHM-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C(=O)c2c[nH]c3ccccc23)C1(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~41%
(1H-Indol-3-yl)... CAS#:895152-66-6 |
| Literature: ABBOTT LABORATORIES Patent: WO2006/69196 A1, 2006 ; Location in patent: Page/Page column 32 ; WO 2006/069196 A1 |
|
~%
(1H-Indol-3-yl)... CAS#:895152-66-6 |
| Literature: Yao; Hsieh; Frost; Fan; Garrison; Daza; Grayson; Zhu; Pai; Chandran; Salyers; Wensink; Honore; Sullivan; Dart; Meyer British Journal of Pharmacology, 2008 , vol. 153, # 2 p. 390 - 401 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indol-3-yl(2,2,3,3-tetramethylcyclopropyl)methanone |
| 1H-indol-3-yl-(2,2,3,3-tetramethylcyclopropyl)methanone |
| Methanone, 1H-indol-3-yl(2,2,3,3-tetramethylcyclopropyl)- |