Fluorescent Red Mega 485 NHS-ester structure
|
Common Name | Fluorescent Red Mega 485 NHS-ester | ||
|---|---|---|---|---|
| CAS Number | 890317-36-9 | Molecular Weight | 599.65200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H33N3O9S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of Fluorescent Red Mega 485 NHS-esterFluorescent Red Mega 485 NHS-ester is an amine conjugating fluorescent biolabel that can be used to label proteins[1]. |
| Name | 3-[4-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-ethylamino]-2-oxochromen-3-yl]pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Fluorescent Red Mega 485 NHS-ester is an amine conjugating fluorescent biolabel that can be used to label proteins[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H33N3O9S |
|---|---|
| Molecular Weight | 599.65200 |
| Exact Mass | 599.19400 |
| PSA | 189.29000 |
| LogP | 1.06800 |
| InChIKey | VKRRBXLGPVGMGA-UHFFFAOYSA-N |
| SMILES | CCN(CCCCCC(=O)ON1C(=O)CCC1=O)c1ccc2cc(-c3cc[n+](CCCS(=O)(=O)[O-])cc3)c(=O)oc2c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| Fluorescent Red Mega 485 NHS-ester |