PMDA structure
|
Common Name | PMDA | ||
|---|---|---|---|---|
| CAS Number | 89-32-7 | Molecular Weight | 218.119 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 398.6±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H2O6 | Melting Point | 283-286 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 183.5±20.4 °C | |
| Symbol |
GHS05, GHS08 |
Signal Word | Danger | |
| Name | 1,2,4,5-Benzenetetracarboxylic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.6±15.0 °C at 760 mmHg |
| Melting Point | 283-286 °C(lit.) |
| Molecular Formula | C10H2O6 |
| Molecular Weight | 218.119 |
| Flash Point | 183.5±20.4 °C |
| Exact Mass | 217.985138 |
| PSA | 94.56000 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| SMILES | O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| Water Solubility | decomposes |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H334 |
| Precautionary Statements | P261-P280-P284-P304 + P340-P305 + P351 + P338 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R41;R42/43 |
| Safety Phrases | S22-S24-S26-S37/39 |
| RIDADR | 1760.0 |
| WGK Germany | 1 |
| RTECS | DB9300000 |
| Hazard Class | 8.0 |
| HS Code | 2917399090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Covalent molecular assembly of oligoimide ultrathin films in supercritical and liquid solvent media.
Langmuir 21(17) , 7812-22, (2005) An ultrathin film of oligoimide has been fabricated on amine-modified substrates of silicon and quartz through alternate layer-by-layer (LBL) assembly of pyromellitic dianhydride (PMDA) and diaminodip... |
|
|
Novel zwitterionic inorganic-organic hybrids: synthesis of hybrid adsorbents and their applications for Cu2+ removal.
J. Hazard. Mater. 186(2-3) , 1335-42, (2011) A series of zwitterionic hybrid adsorbents were prepared via the ring-opening polymerization of pyromellitic acid dianhydride (PMDA) and N-[3-(trimethoxysilyl)propyl] ethylene diamine (TMSPEDA), and a... |
|
|
NTCDA-TTF first axial fusion: emergent panchromatic, NIR optical, multi-state redox and high optical contrast photooxidation.
Chem. Commun. (Camb.) 48(52) , 6475-7, (2012) The first synthetic entry into axially fused NTCDA/PMDA-TTF multipolar molecules demonstrates a high optical contrast photooxidation, panchromism, low HOMO-LUMO gap, generation of a stable radical cat... |
| pyromelliticacidanhydride |
| benzene-1,2,4,5-tetracarboxylic dianhydride |
| Pyromellitic dianhydride |
| pyromellithic dianhydride |
| 1,2,4,5-benzenetetracarboxylic dianhydride |
| 1H,3H-Furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| EINECS 201-898-9 |
| BDFtetron |
| Piromellitic dianhydride |
| Pyromellitic dianhyd |
| MFCD00005005 |
| 1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone |
| Pyromellitic anhydride |
| PMDA |