4-SULFOPHTHALIC ACID structure
|
Common Name | 4-SULFOPHTHALIC ACID | ||
|---|---|---|---|---|
| CAS Number | 89-08-7 | Molecular Weight | 246.19400 | |
| Density | 1.292 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C8H6O7S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Sulfophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292 g/mL at 25 °C |
|---|---|
| Molecular Formula | C8H6O7S |
| Molecular Weight | 246.19400 |
| Exact Mass | 245.98300 |
| PSA | 137.35000 |
| LogP | 1.41050 |
| Index of Refraction | n20/D 1.447 |
| InChIKey | WNKQDGLSQUASME-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Four linear Cu(II)3 subunit-based coordination polymers with various inter-subunit connections, spin ground-states and intra-/inter-subunit magnetic couplings.
Dalton Trans. 44(7) , 3190-9, (2015) Four new 4-amino-1,2,4-triazole (atr)-based coordination polymers, {[Cu2(atr)(H2O)(μ-OH)2(pa)]·H2O}n (), {[Cu3(atr)2(H2O)2(μ-OH)2(npa)2]·2H2O}n (), {[Cu3(atr)5(dca)(μ-OH)(ClO4)2](ClO4)2}n () and {[Cu3... |
| EINECS 201-881-6 |
| MFCD00007494 |
| 4-sulfophthalic acid |