4-HYDROXY-3-PHENYL-PYRAN-2,5-DIONE structure
|
Common Name | 4-HYDROXY-3-PHENYL-PYRAN-2,5-DIONE | ||
|---|---|---|---|---|
| CAS Number | 887407-19-4 | Molecular Weight | 204.17900 | |
| Density | 1.448g/cm3 | Boiling Point | 407.9ºC at 760 mmHg | |
| Molecular Formula | C11H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.9ºC | |
| Name | 4-hydroxy-3-phenylpyran-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 407.9ºC at 760 mmHg |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.17900 |
| Flash Point | 166.9ºC |
| Exact Mass | 204.04200 |
| PSA | 63.60000 |
| LogP | 1.08160 |
| Index of Refraction | 1.636 |
| InChIKey | AFOMWBZLVSMOEM-UHFFFAOYSA-N |
| SMILES | O=C1COC(=O)C(c2ccccc2)=C1O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-hydroxy-3-phenyl-pyran-2,5-dione |