4-hydroxy-3-phenyl-2-(2-phenylmethoxyethyl)-2H-furan-5-one
Modify Date: 2025-08-26 12:49:47
4-hydroxy-3-phenyl-2-(2-phenylmethoxyethyl)-2H-furan-5-one structure
|
Common Name | 4-hydroxy-3-phenyl-2-(2-phenylmethoxyethyl)-2H-furan-5-one | ||
|---|---|---|---|---|
| CAS Number | 105346-31-4 | Molecular Weight | 310.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-phenyl-2-(2-phenylmethoxyethyl)-2H-furan-5-one |
|---|
| Molecular Formula | C19H18O4 |
|---|---|
| Molecular Weight | 310.34400 |
| Exact Mass | 310.12100 |
| PSA | 55.76000 |
| LogP | 3.48800 |
| InChIKey | CNNPHWMQBWFIJL-UHFFFAOYSA-N |
| SMILES | O=C1OC(CCOCc2ccccc2)C(c2ccccc2)=C1O |
|
~69%
4-hydroxy-3-phe... CAS#:105346-31-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 6 p. 2594 - 2597 |
|
~%
4-hydroxy-3-phe... CAS#:105346-31-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 36, # 4 p. 1404 - 1414 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |