eudistomin I structure
|
Common Name | eudistomin I | ||
|---|---|---|---|---|
| CAS Number | 88704-45-4 | Molecular Weight | 235.28400 | |
| Density | 1.35g/cm3 | Boiling Point | 470.8ºC at 760 mmHg | |
| Molecular Formula | C15H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-9H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 470.8ºC at 760 mmHg |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.28400 |
| Flash Point | 238.5ºC |
| Exact Mass | 235.11100 |
| PSA | 41.04000 |
| LogP | 2.73460 |
| Index of Refraction | 1.745 |
| InChIKey | HWONJHNDNBCJGG-UHFFFAOYSA-N |
| SMILES | c1ccc2c(c1)[nH]c1c(C3=NCCC3)nccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| eudistomin I |
| 9H-Pyrido(3,4-b)indole,1-(3,4-dihydro-2H-pyrrol-5-yl) |