eudistomin O
Modify Date: 2024-09-27 12:44:39
eudistomin O structure
|
Common Name | eudistomin O | ||
|---|---|---|---|---|
| CAS Number | 88704-40-9 | Molecular Weight | 247.09100 | |
| Density | 1.699g/cm3 | Boiling Point | 443.6ºC at 760 mmHg | |
| Molecular Formula | C11H7BrN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.1ºC | |
| Name | 7-bromo-9H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.699g/cm3 |
|---|---|
| Boiling Point | 443.6ºC at 760 mmHg |
| Molecular Formula | C11H7BrN2 |
| Molecular Weight | 247.09100 |
| Flash Point | 222.1ºC |
| Exact Mass | 245.97900 |
| PSA | 28.68000 |
| LogP | 3.47860 |
| Index of Refraction | 1.799 |
| InChIKey | QIIQCUUHBSIRSM-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)[nH]c1cnccc12 |
| HS Code | 2933990090 |
|---|
|
~%
eudistomin O CAS#:88704-40-9 |
| Literature: Ritzeler, Olaf; Castro, Alfredo; Grenier, Louis; Soucy, Francois; Hancock, Wayne W.; Mazdiyasni, Hormoz; Palombella, Vito; Adams, Julian Patent: US2002/99068 A1, 2002 ; |
|
~%
eudistomin O CAS#:88704-40-9 |
| Literature: Schumacher, Robert W.; Davidson, Bradley S. Tetrahedron, 1999 , vol. 55, # 4 p. 935 - 942 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Pyrido(3,4-b)indole,7-bromo |
| Eudistomin O |