eudistomin H structure
|
Common Name | eudistomin H | ||
|---|---|---|---|---|
| CAS Number | 88704-44-3 | Molecular Weight | 314.18000 | |
| Density | 1.68g/cm3 | Boiling Point | 516.3ºC at 760 mmHg | |
| Molecular Formula | C15H12BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-bromo-1-(3,4-dihydro-2H-pyrrol-5-yl)-9H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 516.3ºC at 760 mmHg |
| Molecular Formula | C15H12BrN3 |
| Molecular Weight | 314.18000 |
| Exact Mass | 313.02100 |
| PSA | 41.04000 |
| LogP | 3.49710 |
| Index of Refraction | 1.778 |
| InChIKey | BJVWSKGRRKQZGZ-UHFFFAOYSA-N |
| SMILES | Brc1ccc2[nH]c3c(C4=NCCC4)nccc3c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| eudistomin H |
| 9H-Pyrido(3,4-b)indole,6-bromo-1-(3,4-dihydro-2H-pyrrol-5-yl) |