4-nitrobenzene-1,3-dicarbonyl chloride
Modify Date: 2025-08-26 18:15:44
4-nitrobenzene-1,3-dicarbonyl chloride structure
|
Common Name | 4-nitrobenzene-1,3-dicarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 88678-15-3 | Molecular Weight | 248.02000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitrobenzene-1,3-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H3Cl2NO4 |
|---|---|
| Molecular Weight | 248.02000 |
| Exact Mass | 246.94400 |
| PSA | 79.96000 |
| LogP | 2.87600 |
| InChIKey | SMVRLUZQOLUDKJ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])c(C(=O)Cl)c1 |
|
~%
4-nitrobenzene-... CAS#:88678-15-3 |
| Literature: Siegle; Christensen Journal of the American Chemical Society, 1950 , vol. 72, p. 4186 |
|
~%
4-nitrobenzene-... CAS#:88678-15-3 |
| Literature: Guetschow, Michael; Schlenk, Miriam; Gaeb, Juergen; Paskaleva, Minka; Alnouri, Mohamad Wessam; Scolari, Silvia; Iqbal, Jamshed; Mueller, Christa E. Journal of Medicinal Chemistry, 2012 , vol. 55, # 7 p. 3331 - 3341 |
CAS#:19619-22-8
CAS#:87533-55-9
CAS#:52054-41-8| 4-nitroisophthalic acid dichloride |
| 4-Nitroisophthalsaeuredichlorid |
| 1,3-Benzenedicarbonyl dichloride,4-nitro |
| 4-Nitro-isophthaloylchlorid |
| 4-nitroisophthaloyl dichloride |
| 4-nitro-isophthaloyl chloride |