5-nitrobenzene-1,3-dicarbonyl chloride structure
|
Common Name | 5-nitrobenzene-1,3-dicarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 13438-30-7 | Molecular Weight | 248.02000 | |
| Density | 1.609g/cm3 | Boiling Point | 349.2ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 5-nitrobenzene-1,3-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2NO4 |
| Molecular Weight | 248.02000 |
| Flash Point | 165ºC |
| Exact Mass | 246.94400 |
| PSA | 79.96000 |
| LogP | 2.87600 |
| Vapour Pressure | 4.78E-05mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | OHIVUAREQFICPK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc(C(=O)Cl)cc([N+](=O)[O-])c1 |
| HS Code | 2917399090 |
|---|
|
~99%
5-nitrobenzene-... CAS#:13438-30-7 |
| Literature: Dirksen, Anouk; Hahn, Uwe; Schwanke, Frank; Nieger, Martin; Reek, Joost N. H.; Voegtle, Fritz; De Cola, Luisa Chemistry - A European Journal, 2004 , vol. 10, # 8 p. 2036 - 2047 |
|
~%
5-nitrobenzene-... CAS#:13438-30-7 |
| Literature: The Scripps Research Institute Patent: US2002/115092 A1, 2002 ; |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-nitroisophthaloyl dichloride |
| EINECS 236-575-1 |
| 5-nitrobenzene-1,3-dioyl dichloride |
| 5-nitro-1,3-benzenedicarbonylchloride |
| 5-nitro-isophthaloyl chloride |
| 5-nitroisophthalic acid dichloride |