4-methoxyisophthaloyl dichloride
Modify Date: 2025-09-11 09:11:11
4-methoxyisophthaloyl dichloride structure
|
Common Name | 4-methoxyisophthaloyl dichloride | ||
|---|---|---|---|---|
| CAS Number | 13235-60-4 | Molecular Weight | 233.04800 | |
| Density | 1.401g/cm3 | Boiling Point | 344.5ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | 4-methoxybenzene-1,3-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 344.5ºC at 760 mmHg |
| Molecular Formula | C9H6Cl2O3 |
| Molecular Weight | 233.04800 |
| Flash Point | 151.9ºC |
| Exact Mass | 231.96900 |
| PSA | 43.37000 |
| LogP | 2.45320 |
| Vapour Pressure | 6.54E-05mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | FKPCRVTXBLUQBV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Cl)cc1C(=O)Cl |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Methoxy-isophthalsaeure-dichlorid |
| 4-Methoxy-isophthaloylchlorid |
| 4-methoxylisophthaloyl dichloride |
| 4-methoxy-isophthaloyl chloride |
| 1,3-Benzenedicarbonyldichloride,4-methoxy |
| 4-methoxy-1,3-benzenedicarbonyl dichloride |
| EINECS 236-209-0 |
| 4-methoxy-1,3-dicarboxylic acid dichloride |
| 4-Methoxyisophthaloyl dichloride |
| 4-Methoxyisophthaloyldichlorid |