N-(4-Bromo-2-nitrophenyl)acetamide structure
|
Common Name | N-(4-Bromo-2-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 881-50-5 | Molecular Weight | 259.057 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 416.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H7BrN2O3 | Melting Point | 102-104ºC | |
| MSDS | N/A | Flash Point | 205.9±25.9 °C | |
| Name | N-(4-bromo-2-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.8±35.0 °C at 760 mmHg |
| Melting Point | 102-104ºC |
| Molecular Formula | C8H7BrN2O3 |
| Molecular Weight | 259.057 |
| Flash Point | 205.9±25.9 °C |
| Exact Mass | 257.963989 |
| PSA | 74.92000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | GUBNCRISSRANNO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Br)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Bromo-2-nitrophenyl)acetamide |
| N1-(4-bromo-2-nitrophenyl)acetamide |
| Acetamide, N-(4-bromo-2-nitrophenyl)- |
| N-(4-bromo-2-nitro-phenyl)-acetamide |
| acetic acid-(4-bromo-2-nitro-anilide) |
| 4-Brom-2-nitro-acetanilid |
| Essigsaeure-(4-brom-2-nitro-anilid) |
| 2-acetamido-5-bromonitrobenzene |
| 4'-Bromo-2'-nitroacetanilide |