Fortuneine
Modify Date: 2025-08-25 19:34:29
Fortuneine structure
|
Common Name | Fortuneine | ||
|---|---|---|---|---|
| CAS Number | 87340-25-8 | Molecular Weight | 312.403 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 456.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.2±26.0 °C | |
Use of FortuneineFortuneine is a homoerythrina alkaloid from Cephalotaxus fortunei[1]. |
| Name | (9S,10aS)-9,12,13-trimethoxy-2,3,9,10-tetrahydro-1H,5H-benzo[3,4]azepino[2,1-i]indole |
|---|---|
| Synonym | More Synonyms |
| Description | Fortuneine is a homoerythrina alkaloid from Cephalotaxus fortunei[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 456.6±45.0 °C at 760 mmHg |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 312.403 |
| Flash Point | 156.2±26.0 °C |
| Exact Mass | 312.172546 |
| PSA | 30.93000 |
| LogP | 3.99 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | FCYJGRFDMUVIHS-UZLBHIALSA-N |
| SMILES | COc1cc2c(cc1OC)C13CC(OC)C=CC1=CCN3CCC2 |
| Hazard Codes | Xi |
|---|
| Benzo[a]benzo[1,4]cyclobuta[1,2-c]cycloheptene, 1,2,5a,6,7,8-hexahydro-2,10,11-trimethoxy-, (2S,12bS)- |
| (2S,12bS)-2,10,11-Trimethoxy-1,2,5a,6,7,8-hexahydrobenzo[a]benzo[1,4]cyclobuta[1,2-c][7]annulene |