MK-3984
Modify Date: 2025-08-27 08:55:42
MK-3984 structure
|
Common Name | MK-3984 | ||
|---|---|---|---|---|
| CAS Number | 871325-55-2 | Molecular Weight | 395.27 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 475.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H12F7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1±28.7 °C | |
Use of MK-3984MK-3984 is a selective androgen receptor modulator (SARM). MK-3984 can be used for the research of muscle wasting associated with cancer[1]. |
| Name | MK-3984 |
|---|---|
| Synonym | More Synonyms |
| Description | MK-3984 is a selective androgen receptor modulator (SARM). MK-3984 can be used for the research of muscle wasting associated with cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.1±45.0 °C at 760 mmHg |
| Molecular Formula | C17H12F7NO2 |
| Molecular Weight | 395.27 |
| Flash Point | 241.1±28.7 °C |
| Exact Mass | 395.075623 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | YSMGNNKNGUPHCD-OAHLLOKOSA-N |
| SMILES | O=C(NCc1cc(C(F)(F)F)ccc1F)C(O)(c1ccccc1)C(F)(F)F |
| NDR4H1Q159 |
| Benzeneacetamide, N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-α-hydroxy-α-(trifluoromethyl)-, (αR)- |
| MK-3984 |
| (2R)-3,3,3-Trifluoro-N-[2-fluoro-5-(trifluoromethyl)benzyl]-2-hydroxy-2-phenylpropanamide |