2-(3-chlorophenyl)-4-isocyanato-1,3-thiazole structure
|
Common Name | 2-(3-chlorophenyl)-4-isocyanato-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 868755-59-3 | Molecular Weight | 236.67700 | |
| Density | 1.41g/cm3 | Boiling Point | 369.7ºC at 760 mmHg | |
| Molecular Formula | C10H5ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.4ºC | |
| Name | 2-(3-chlorophenyl)-4-isocyanato-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 369.7ºC at 760 mmHg |
| Molecular Formula | C10H5ClN2OS |
| Molecular Weight | 236.67700 |
| Flash Point | 177.4ºC |
| Exact Mass | 235.98100 |
| PSA | 70.56000 |
| LogP | 3.43080 |
| Index of Refraction | 1.676 |
| InChIKey | CSRQTKPTVAWVQQ-UHFFFAOYSA-N |
| SMILES | O=C=Nc1csc(-c2cccc(Cl)c2)n1 |
| Risk Phrases | 20/21/22-42 |
|---|---|
| Safety Phrases | 22-26-36/37/39 |
| RIDADR | UN 2206 |
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(2,5-DIFLUOROPHENYL)AMINO-4-(2-HYDROXYPHENYL)-1,3-THIAZOLE HYDROBROMIDE |
| Thiazole,2-(3-chlorophenyl)-4-isocyanato |