2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl chloride
Modify Date: 2025-09-13 17:42:16
2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl chloride structure
|
Common Name | 2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 868755-69-5 | Molecular Weight | 258.12400 | |
| Density | 1.468g/cm3 | Boiling Point | 395.1ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 2-(3-chlorophenyl)-1,3-thiazole-4-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760 mmHg |
| Molecular Formula | C10H5Cl2NOS |
| Molecular Weight | 258.12400 |
| Flash Point | 192.8ºC |
| Exact Mass | 256.94700 |
| PSA | 58.20000 |
| LogP | 3.84250 |
| Index of Refraction | 1.628 |
| InChIKey | PBAOKEBRFVHPSM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1csc(-c2cccc(Cl)c2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Thiazolecarbonylchloride,2-(3-chlorophenyl) |