Methyl 4-methyl-5-nitropicolinate structure
|
Common Name | Methyl 4-methyl-5-nitropicolinate | ||
|---|---|---|---|---|
| CAS Number | 868551-30-8 | Molecular Weight | 196.160 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 356.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.6±27.9 °C | |
| Name | methyl 4-methyl-5-nitropyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.9±42.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.160 |
| Flash Point | 169.6±27.9 °C |
| Exact Mass | 196.048401 |
| PSA | 85.01000 |
| LogP | 0.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | JOCVMGPJNBRFGT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)c([N+](=O)[O-])cn1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
Methyl 4-methyl... CAS#:868551-30-8 |
| Literature: NOVARTIS AG; HOMMEL, Ulrich; LORTHIOIS, Edwige Liliane Jeanne; MAIBAUM, Juergen Klaus; OSTERMANN, Nils; RANDL, Stefan Andreas; VULPETTI, Anna Patent: WO2014/2057 A1, 2014 ; Location in patent: Page/Page column 56 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 4-methyl-5-nitro-2-pyridinecarboxylate |
| 2-Pyridinecarboxylic acid, 4-methyl-5-nitro-, methyl ester |
| 4-methyl-5-nitro-pyridine-2-carboxylic acid methyl ester |
| methyl 4-methyl-5-nitropicolinate |