Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate structure
|
Common Name | Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 152628-01-8 | Molecular Weight | 280.276 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 468.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9±28.7 °C | |
| Name | Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 468.1±45.0 °C at 760 mmHg |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.276 |
| Flash Point | 236.9±28.7 °C |
| Exact Mass | 280.105927 |
| PSA | 101.22000 |
| LogP | 3.12 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | IGCBUUTXGYCQAI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1c(C)cc(C(=O)OC)cc1[N+](=O)[O-] |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
|
~91%
Methyl 4-(butyr... CAS#:152628-01-8 |
| Literature: Boehringer Ingelheim Pharma GmbH and Co.KG Patent: EP1173407 B1, 2005 ; Location in patent: Page/Page column 5 ; |
|
~%
Methyl 4-(butyr... CAS#:152628-01-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 40, # 6 p. 1107 - 1112 |
|
~%
Methyl 4-(butyr... CAS#:152628-01-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 40, # 6 p. 1107 - 1112 |
|
~%
Methyl 4-(butyr... CAS#:152628-01-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 40, # 6 p. 1107 - 1112 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD08062447 |
| 4-butyramido-3-methyl-5-nitro methyl benzoate |
| 3-Methyl-4-butyrylamido-5-nitro benzoic acid methyl ester |
| 4-BUTANAMIDE-3-METHYL-5-NITROBENZENE CARBOXYLATE ACID |
| Benzoic acid, 3-methyl-5-nitro-4-[(1-oxobutyl)amino]-, methyl ester |
| Methyl-4-(butanoylamino)-3-methyl-5-nitrobenzolcarboxylat |
| 4-BUTANAMIDO-3-METHYL-5-NITROBENZOIC ACID |
| Methyl-4-(butyrylamino)-3-methyl-5-nitrobenzoate |
| 4-butyrylamino-3-methyl-5-nitro-benzoic acid methyl ester |
| Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate |
| Methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate |