potassium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate structure
|
Common Name | potassium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 866-83-1 | Molecular Weight | 230.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7KO7 | Melting Point | 246-248ºC | |
| MSDS | USA | Flash Point | N/A | |
| Name | Potassium Dihydrogen Citrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 246-248ºC |
|---|---|
| Molecular Formula | C6H7KO7 |
| Molecular Weight | 230.21400 |
| Exact Mass | 229.98300 |
| PSA | 134.96000 |
| Appearance of Characters | Powder/Chunks |
| InChIKey | WKZJASQVARUVAW-UHFFFAOYSA-M |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)O.[K+] |
| Water Solubility | H2O: 0.5 M at 20 °C, clear, colorless | Soluble in water. Slightly soluble in ethanol |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918199090 |
|
~%
potassium dihyd... CAS#:866-83-1 |
| Literature: US7351853 B2, ; Page/Page column 12 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| potassium dihydrogen citrate |
| MFCD00036472 |
| EINECS 212-753-4 |